| CONTENT | |
Explosion-proof Switches
1. ZXF8030/51-Explosion-proof Lighting Switches
|
Features The enclosure is the structure of increasing safety, there are some element of isolating explosion inside. The enclosure is made of fibreglass reinforced polyester resin thus possesses good performances such as fine appearance, erosion-proof, resisting static electricity, shock-proof, good thermal stability and anti-corrosive etc. These elements have more advantage, such as compact structure, reliable quality, smaller volume, high capacity of turning on/off, and long life. All screws are made of stainless steel. May use cables to connect it. |
 |
Specification： 1. Rated voltage: 220V 2. Rated current: 6A 3. Ex-mark: edIICT6 4. Protective-class: IP65 5. Erosion-proof-class: WF2 6. Inlet size: M20×Ý1.5, G20 7. Cable dia.: φ8~φ15 |
2. SWB(C)-10-Explosion-proof Lighting Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. There is a switch of isolating explosion inside. The lid is inserted in the enclosure, and there are some seal between the lid and the enclosure, and operating the lever. So the protective-classes can is up IP65. May use tubes or cables to connect it. |
 |
Specification： 1. Rated voltage: 220V 2. Rated current: 10A 3. Ex-mark: edIIBT6, edIICT6 4. Protective-class: IP54, IP65 5. Erosion-proof-classes: W, WF1, WF2 6. Inlet size: G20 7. Cable dia.: φ8~φ15 |
3. SW-4 Explosion-proof Lighting Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. It is suitable for switching off/on lighting fixture and signal fixture. May use tubes or cables to connect it. |
 |
Specification： 1. Rated voltage: 220V 2. Rated current: 4A 3. Ex-mark: dIIBT6 4. Protective-class: IP54, IP65 5. Erosion-proof-class: W, WF1, WF2 6. Inlet size: G20 7. Cable dia.: φ8~φ15 |
4. ZXF8038-Series of Explosion-proof Control Switches
|
Features The enclosure is the structure of increasing safety, there are some element of isolating explosion inside. The enclosure is made of fibreglass reinforced polyester resin thus possesses good performances such as fine appearance, erosion-proof, resisting static electricity, shock-proof, good thermal stability, etc. These elements of isolating explosion have more advantage, such as compact structure, reliable quality, smaller volume, high capacity of turning on/off, and long life. User may select the arrangement of element. All screws are made of stainless steel. May use cables to connect it. |
 |
 |
 |
| ZXF8038/7 | ZXF8038/8 | ZXF8038/9 |
Specification
| Type | Kind of use |
Voltage (V) |
Current (A) |
Ex-mark | Protective-class |
Erosion-proof -classes |
Inlet size /Cable dia.(mm) |
|
ZXF8038/7 ZXF8038/8 |
AC11 | 220 | 6 | edIICT6 | IP65 | WF2 |
M20×Ý1.5/φ12~φ15 G20/φ12~φ15 |
| 380 | 4 | ||||||
|
DC11 (L/R=100ms) |
24 | 6 | |||||
| 60 | 0.8 | ||||||
| 110 | 0.5 | ||||||
| 220 | 0.2 | ||||||
| ZXF8038/9 | AC3 | 660 | 4 | ||||
| 380 | 16 | ||||||
| AC11 | 660 | 2.5 | |||||
| 380 | 6 | ||||||
|
DC11 (L/R=100ms) |
110 | 0.4 |
5. SWYB(C)-5 Explosion-proof Delay Lighting Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. The switch automatically is turned off by electronic circuit. It may be use in the corridor lighting or tank inspection lighting. The switch is sealed by epoxy resin. So it has many advantages such as smaller volume, long life etc. The special functions may be made at customer's request, such as current or control by lighting etc. May use tubes or cables to connect it. |
|
Specification： 1. Rated voltage: ~12, ~24, ~36, ~220V 2. Rated current: 0.5A 3. Ex-mark: dIIBT6, dIICT6 4. Protective-class: IP54, IP65 5. Erosion-proof-class: W, WF1, WF2 6. Inlet size: G20 7. Cable dia.: φ8~φ15 |
6. BHZ-Explosion-proof Unit Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. It may be used as a power switch in the circuit of AC 50Hz, 380V, and current below 60A. It may be use to control the motor start, changing speed, stop and changing way etc. May use tubes or cables to connect it. |
 |
Specification： 1. Rated voltage: 380V 2. Rated current: 10, 25, 40, 60A 3. Ex-mark: dIIBT6, dIICT6 4. Protective-class: IP54, IP65 5. Erosion-proof-class: W, WF1, WF2 6. Inlet size: G20 7. Cable dia.: φ8~φ15 |
7. dLXK-Explosion-proof Stroke Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. May use tubes or cables to connect it. |
 |
Specification： 1. Rated voltage: 380V 2. Rated current: 2A 3. Ex-mark: dIIBT6 4. Protective-class: IP54, IP65 5. Erosion-proof-class: W, WF1, WF2 6. Inlet size: G15 7. Cable dia.: φ7~φ9 |
| Limiting code | Limiting type | Moving stroke | Over-stroke | Force (Kg) | Contact type |
| Z | Piston | 1~3mm | ≥2mm | ≤2.0 |
One open One close |
| L | Piston with roller | ||||
| B | Arm with roller | 12º‚´~15º‚´ | ≥30º‚´ | ≤1.0 | |
| H | Forking arm with roller | ≥45º‚´ | ≤1.5 |
8. BH3-Explosion-proof Knife Switches
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, it may prevent erosions. It may be used to be not frequently turned on/off the circuit of load and protect the equipment when the circuit is short circuit. There are knife switches, fuses and the element of putting out the electric arc inside, so it may quickly turn on/off. May use tubes or cables to connect it. |
 |
 |
Specification: 1. Rated voltage: 380V 2. Rated current: 10, 20, 30, 60, 100, 200A 3. Ex-mark: dIIBT6, dIICT6 4. Protective-class: IP54, IP65 5. Erosion-proof-class: W, WF1, WF2 6. Inlet size: G20~G40 7. Cable dia.: φ8~φ26 |
| CH3-10 | BH3-20 | |
8. BDZ-Explosion-proof Circuit Breakers
|
Features The enclosure is made of casting aluminum alloy, the surfaces are sprayed with plastics, and it may prevent erosions.
There is a C45N(C45AD or NC100H or DZ20) circuit breaker. May add to indicating light for displaying ON/OFF.
When the circuit is overloading or short it may automatically cut off the power supply.
May add to some protecting function such as lower voltage, drop voltage and leak.
C45N is suitable for the lighting distribution system, C45AD is suitable for the power distribution system. May use tubes or cables to connect it. |
 |
Specification: 1. Rated voltage: 220, 380V 2. Inside C45N or C45AD, set current: 1~40A Inside NC100H, set current: 50~63A Inside DZ20-200, set current: 80~A Inside DZ20-400, set current: 180~350A 3. Kind of use: AC1, AC3 4. No. of poles: 1P+N+PE, 2P+N+PE, 3P+N+PE 5. Ex-mark: dIIBT4, dIICT4 6. Protective-class: IP54, IP65 7. Erosion-proof-class: W, WF1, WF2 8. Inlet size: G20~G50 9. Cable dia.: φ8~φ35 |
| BDZ-32/2P | |
 |
|
| BDZ-32/2P | |
 |
|
| CDZ-32/2P |
| CONTENT | |